RCS-8 |
|
Legal status |
|
---|
|
2-(2-Methoxyphenyl)-1-[1-(2-cyclohexylethyl)indol-3-yl]ethanone
|
CAS Number | |
---|
ChemSpider | |
---|
UNII | |
---|
CompTox Dashboard (EPA) | |
---|
|
Formula | C25H29NO2 |
---|
Molar mass | 375.512 g·mol−1 |
---|
3D model (JSmol) | |
---|
COc1ccccc1CC(=O)c2cn(c3c2cccc3)CCC4CCCCC4
|
InChI=1S/C25H29NO2/c1-28-25-14-8-5-11-20(25)17-24(27)22-18-26(23-13-7-6-12-21(22)23)16-15-19-9-3-2-4-10-19/h5-8,11-14,18-19H,2-4,9-10,15-17H2,1H3 YKey:BSQFBMXCQIKYNI-UHFFFAOYSA-N Y
|
N Y (what is this?) (verify) |
RCS-8 (also known as 1-(2-cyclohexylethyl)-3-(2-methoxyphenylacetyl)indole, SR-18, and BTM-8) is a synthetic cannabinoid that has been found as an ingredient of "herbal smoking blends". It can be described as an analogue of JWH-250 with the 1-pentyl group replaced by 1-(2-cyclohexylethyl), and can be expected to be less potent than JWH-250.[1] All CB1 receptor agonists of the 3-phenylacetylindole class such as RCS-8 are Schedule I Controlled Substances within the United States.[2]
See also
References
- ^ Huffman JW, Dai D, Martin BR, Compton DR (1994). "Design, Synthesis and Pharmacology of Cannabimimetic Indoles". Bioorganic & Medicinal Chemistry Letters. 4 (4): 563–566. doi:10.1016/S0960-894X(01)80155-4.
- ^ 21 U.S.C. § 812: Schedules of controlled substances
|
---|
Phytocannabinoids (comparison) | Cannabibutols | |
---|
Cannabichromenes | |
---|
Cannabicyclols | |
---|
Cannabidiols | |
---|
Cannabielsoins | |
---|
Cannabigerols | |
---|
Cannabiphorols | |
---|
Cannabinols |
- CBN
- CBNA
- CBN-C1
- CBN-C2
- CBN-C4
- CBNM
- CBND
- CBNP
- CBVD
|
---|
Cannabitriols | |
---|
Cannabivarins | |
---|
Delta-3-tetrahydrocannabinols | |
---|
Delta-4-tetrahydrocannabinols | |
---|
Delta-7-tetrahydrocannabinols | |
---|
Delta-8-tetrahydrocannabinols | |
---|
Delta-9-tetrahydrocannabinols | |
---|
Delta-10-Tetrahydrocannabinols | |
---|
Delta-11-Tetrahydrocannabinols | |
---|
Miscellaneous cannabinoids | |
---|
Active metabolites | |
---|
|
---|
Endocannabinoids | |
---|
Synthetic cannabinoid receptor agonists / neocannabinoids | Classical cannabinoids (dibenzopyrans) | |
---|
Non-classical cannabinoids | |
---|
Adamantoylindoles | |
---|
Benzimidazoles | |
---|
Benzoylindoles | |
---|
Cyclohexylphenols | |
---|
Eicosanoids | |
---|
Indazole-3- carboxamides | |
---|
Indole-3-carboxamides | |
---|
Indole-3-carboxylates | |
---|
Naphthoylindazoles | |
---|
Naphthoylindoles | |
---|
Naphthoylpyrroles | |
---|
Naphthylmethylindenes | |
---|
Naphthylmethylindoles | |
---|
Phenylacetylindoles | |
---|
Pyrazolecarboxamides | |
---|
Tetramethylcyclo- propanoylindazoles | |
---|
Tetramethylcyclo- propanoylindoles | |
---|
Others | |
---|
|
---|
Allosteric CBRTooltip Cannabinoid receptor ligands | |
---|
Endocannabinoid enhancers (inactivation inhibitors) | |
---|
Anticannabinoids (antagonists/inverse agonists/antibodies) | |
---|
|